C14H26N3O2+ — CID 89444163
3-[2-(2-amino-5-hydroxyanilino)ethoxy]propyl-trimethylazanium (PubChem CID 89444163) has the molecular formula C14H26N3O2+ and a molecular weight of 268.38 g/mol. Its IUPAC name is 3-[2-(2-amino-5-hydroxyanilino)ethoxy]propyl-trimethylazanium.
| Compound Name | 3-[2-(2-amino-5-hydroxyanilino)ethoxy]propyl-trimethylazanium |
|---|---|
| PubChem CID | 89444163 |
| Molecular Formula | C14H26N3O2+ |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 3-[2-(2-amino-5-hydroxyanilino)ethoxy]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCOCCNc1cc(O)ccc1N |
| InChI | InChI=1S/C14H25N3O2/c1-17(2,3)8-4-9-19-10-7-16-14-11-12(18)5-6-13(14)15/h5-6,11,16H,4,7-10,15H2,1-3H3/p+1 |
| InChIKey | QTEVGPIPEUVHPF-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|