C14H22N5O+ — CID 89451678
4-amino-3-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]ethylamino]phenol (PubChem CID 89451678) has the molecular formula C14H22N5O+ and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-amino-3-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]ethylamino]phenol.
| Compound Name | 4-amino-3-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]ethylamino]phenol |
|---|---|
| PubChem CID | 89451678 |
| Molecular Formula | C14H22N5O+ |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-amino-3-[2-[2-(3-methylimidazol-3-ium-1-yl)ethylamino]ethylamino]phenol |
| SMILES | C[n+]1ccn(CCNCCNc2cc(O)ccc2N)c1 |
| InChI | InChI=1S/C14H21N5O/c1-18-8-9-19(11-18)7-6-16-4-5-17-14-10-12(20)2-3-13(14)15/h2-3,8-11,16-17H,4-7,15H2,1H3/p+1 |
| InChIKey | UCLDJXCSUSDSQN-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|