C27H40ClN7 — CID 87988122
4-[4-(4-amino-3-methylphenyl)-7-[3-(3-methylimidazol-3-ium-1-yl)propyl]-1,4,7-triazonan-1-yl]-2-methylaniline chloride (PubChem CID 87988122) has the molecular formula C27H40ClN7 and a molecular weight of 498.12 g/mol. Its IUPAC name is 4-[4-(4-amino-3-methylphenyl)-7-[3-(3-methylimidazol-3-ium-1-yl)propyl]-1,4,7-triazonan-1-yl]-2-methylaniline chloride.
| Compound Name | 4-[4-(4-amino-3-methylphenyl)-7-[3-(3-methylimidazol-3-ium-1-yl)propyl]-1,4,7-triazonan-1-yl]-2-methylaniline chloride |
|---|---|
| PubChem CID | 87988122 |
| Molecular Formula | C27H40ClN7 |
| Molecular Weight | 498.12 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 4-[4-(4-amino-3-methylphenyl)-7-[3-(3-methylimidazol-3-ium-1-yl)propyl]-1,4,7-triazonan-1-yl]-2-methylaniline chloride |
| SMILES | Cc1cc(N2CCN(CCCn3cc[n+](C)c3)CCN(c3ccc(N)c(C)c3)CC2)ccc1N.[Cl-] |
| InChI | InChI=1S/C27H40N7.ClH/c1-22-19-24(5-7-26(22)28)33-15-13-31(9-4-10-32-12-11-30(3)21-32)14-16-34(18-17-33)25-6-8-27(29)23(2)20-25;/h5-8,11-12,19-21H,4,9-10,13-18,28-29H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | SZVUXAVKSKWWIR-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.12 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|