C20H29N5 — CID 23103839
4-[4-(4-amino-3-methylphenyl)-1,4,7-triazonan-1-yl]-2-methylaniline (PubChem CID 23103839) has the molecular formula C20H29N5 and a molecular weight of 339.49 g/mol. Its IUPAC name is 4-[4-(4-amino-3-methylphenyl)-1,4,7-triazonan-1-yl]-2-methylaniline.
| Compound Name | 4-[4-(4-amino-3-methylphenyl)-1,4,7-triazonan-1-yl]-2-methylaniline |
|---|---|
| PubChem CID | 23103839 |
| Molecular Formula | C20H29N5 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 4-[4-(4-amino-3-methylphenyl)-1,4,7-triazonan-1-yl]-2-methylaniline |
| SMILES | Cc1cc(N2CCNCCN(c3ccc(N)c(C)c3)CC2)ccc1N |
| InChI | InChI=1S/C20H29N5/c1-15-13-17(3-5-19(15)21)24-9-7-23-8-10-25(12-11-24)18-4-6-20(22)16(2)14-18/h3-6,13-14,23H,7-12,21-22H2,1-2H3 |
| InChIKey | RCCMMRAJJFNDHO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|