C12H19N3 — CID 4738791
2,4-dimethyl-5-piperazin-1-ylaniline (PubChem CID 4738791) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 2,4-dimethyl-5-piperazin-1-ylaniline.
| Compound Name | 2,4-dimethyl-5-piperazin-1-ylaniline |
|---|---|
| PubChem CID | 4738791 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 2,4-dimethyl-5-piperazin-1-ylaniline |
| SMILES | Cc1cc(C)c(N2CCNCC2)cc1N |
| InChI | InChI=1S/C12H19N3/c1-9-7-10(2)12(8-11(9)13)15-5-3-14-4-6-15/h7-8,14H,3-6,13H2,1-2H3 |
| InChIKey | MZLNPNLPUNIXSZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|