C12H17N3O2 — CID 62137118
6-piperazin-1-yl-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 62137118) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-piperazin-1-yl-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-piperazin-1-yl-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 62137118 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-piperazin-1-yl-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Nc1cc2c(cc1N1CCNCC1)OCCO2 |
| InChI | InChI=1S/C12H17N3O2/c13-9-7-11-12(17-6-5-16-11)8-10(9)15-3-1-14-2-4-15/h7-8,14H,1-6,13H2 |
| InChIKey | FTFDFYBUDOFUQI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|