C15H23N3O3 — CID 82550270
1-(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-3-piperazin-1-ylpropan-1-ol (PubChem CID 82550270) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-3-piperazin-1-ylpropan-1-ol.
| Compound Name | 1-(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-3-piperazin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 82550270 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-3-piperazin-1-ylpropan-1-ol |
| SMILES | Nc1cc2c(cc1C(O)CCN1CCNCC1)OCCO2 |
| InChI | InChI=1S/C15H23N3O3/c16-12-10-15-14(20-7-8-21-15)9-11(12)13(19)1-4-18-5-2-17-3-6-18/h9-10,13,17,19H,1-8,16H2 |
| InChIKey | KJJMQOIJHQWIRV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|