C14H20N2O3 — CID 3261136
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperazin-1-ylethanol (PubChem CID 3261136) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperazin-1-ylethanol.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 3261136 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperazin-1-ylethanol |
| SMILES | OC(CN1CCNCC1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H20N2O3/c17-12(10-16-5-3-15-4-6-16)11-1-2-13-14(9-11)19-8-7-18-13/h1-2,9,12,15,17H,3-8,10H2 |
| InChIKey | HYYXHBZBLHCDDP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |