C16H16N2O2 — CID 62204823
6-(1,3-dihydroisoindol-2-yl)-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 62204823) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 6-(1,3-dihydroisoindol-2-yl)-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-(1,3-dihydroisoindol-2-yl)-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 62204823 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 6-(1,3-dihydroisoindol-2-yl)-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Nc1cc2c(cc1N1Cc3ccccc3C1)OCCO2 |
| InChI | InChI=1S/C16H16N2O2/c17-13-7-15-16(20-6-5-19-15)8-14(13)18-9-11-3-1-2-4-12(11)10-18/h1-4,7-8H,5-6,9-10,17H2 |
| InChIKey | ZNLZFJSNBAWGST-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|