C11H18N4 — CID 175106562
5,6-dimethyl-4-piperazin-1-ylpyridin-2-amine (PubChem CID 175106562) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 5,6-dimethyl-4-piperazin-1-ylpyridin-2-amine.
| Compound Name | 5,6-dimethyl-4-piperazin-1-ylpyridin-2-amine |
|---|---|
| PubChem CID | 175106562 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 5,6-dimethyl-4-piperazin-1-ylpyridin-2-amine |
| SMILES | Cc1nc(N)cc(N2CCNCC2)c1C |
| InChI | InChI=1S/C11H18N4/c1-8-9(2)14-11(12)7-10(8)15-5-3-13-4-6-15/h7,13H,3-6H2,1-2H3,(H2,12,14) |
| InChIKey | CLDVFSMGZAQAEM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |