C8H14N6 — CID 21363888
6-piperazin-1-ylpyrimidine-2,4-diamine (PubChem CID 21363888) has the molecular formula C8H14N6 and a molecular weight of 194.24 g/mol. Its IUPAC name is 6-piperazin-1-ylpyrimidine-2,4-diamine.
| Compound Name | 6-piperazin-1-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 21363888 |
| Molecular Formula | C8H14N6 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 6-piperazin-1-ylpyrimidine-2,4-diamine |
| SMILES | Nc1cc(N2CCNCC2)nc(N)n1 |
| InChI | InChI=1S/C8H14N6/c9-6-5-7(13-8(10)12-6)14-3-1-11-2-4-14/h5,11H,1-4H2,(H4,9,10,12,13) |
| InChIKey | UFTGFBAOILEKOZ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |