C12H22N6 — CID 80824437
6-(4-butan-2-ylpiperazin-1-yl)pyrimidine-2,4-diamine (PubChem CID 80824437) has the molecular formula C12H22N6 and a molecular weight of 250.35 g/mol. Its IUPAC name is 6-(4-butan-2-ylpiperazin-1-yl)pyrimidine-2,4-diamine.
| Compound Name | 6-(4-butan-2-ylpiperazin-1-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80824437 |
| Molecular Formula | C12H22N6 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 6-(4-butan-2-ylpiperazin-1-yl)pyrimidine-2,4-diamine |
| SMILES | CCC(C)N1CCN(c2cc(N)nc(N)n2)CC1 |
| InChI | InChI=1S/C12H22N6/c1-3-9(2)17-4-6-18(7-5-17)11-8-10(13)15-12(14)16-11/h8-9H,3-7H2,1-2H3,(H4,13,14,15,16) |
| InChIKey | PEDUJMLJMKDDHG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |