C14H21N5S — CID 103327357
4-(4-butan-2-ylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103327357) has the molecular formula C14H21N5S and a molecular weight of 291.42 g/mol. Its IUPAC name is 4-(4-butan-2-ylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(4-butan-2-ylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103327357 |
| Molecular Formula | C14H21N5S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 4-(4-butan-2-ylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCC(C)N1CCN(c2nc(N)nc3sccc23)CC1 |
| InChI | InChI=1S/C14H21N5S/c1-3-10(2)18-5-7-19(8-6-18)12-11-4-9-20-13(11)17-14(15)16-12/h4,9-10H,3,5-8H2,1-2H3,(H2,15,16,17) |
| InChIKey | BNZIVEKIXFPVMC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |