C12H16N4S — CID 103323791
4-(4-methylpiperidin-1-yl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103323791) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-(4-methylpiperidin-1-yl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(4-methylpiperidin-1-yl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103323791 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-(4-methylpiperidin-1-yl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CC1CCN(c2nc(N)nc3sccc23)CC1 |
| InChI | InChI=1S/C12H16N4S/c1-8-2-5-16(6-3-8)10-9-4-7-17-11(9)15-12(13)14-10/h4,7-8H,2-3,5-6H2,1H3,(H2,13,14,15) |
| InChIKey | WQLSZMMPZCNDBC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |