About 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine
2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine (PubChem CID 72928054) has the molecular formula C16H22N4S2
and a molecular weight of 334.51 g/mol. Its IUPAC name is 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine |
| PubChem CID | 72928054 |
| Molecular Formula | C16H22N4S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine |
| SMILES | Cc1nc(N2CCC(N3CCSCC3)CC2)c2ccsc2n1 |
| InChI | InChI=1S/C16H22N4S2/c1-12-17-15(14-4-9-22-16(14)18-12)20-5-2-13(3-6-20)19-7-10-21-11-8-19/h4,9,13H,2-3,5-8,10-11H2,1H3 |
| InChIKey | FFCMURRVJVKJDM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine?
The IUPAC name of 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine (CID 72928054) is 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine.
What is the SMILES notation for 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine?
The canonical SMILES for 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine is Cc1nc(N2CCC(N3CCSCC3)CC2)c2ccsc2n1.
What is the InChIKey of 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine?
The InChIKey is FFCMURRVJVKJDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4S2/c1-12-17-15(14-4-9-22-16(14)18-12)20-5-2-13(3-6-20)19-7-10-21-11-8-19/h4,9,13H,2-3,5-8,10-11H2,1H3.
What are the key properties of 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine?
2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine has a molecular weight of 334.51 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(4-thiomorpholin-4-ylpiperidin-1-yl)thieno[2,3-d]pyrimidine is sourced from PubChem (CID 72928054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).