C14H20N4S2 — CID 103325584
N-propyl-4-(1,4-thiazepan-4-yl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103325584) has the molecular formula C14H20N4S2 and a molecular weight of 308.48 g/mol. Its IUPAC name is N-propyl-4-(1,4-thiazepan-4-yl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | N-propyl-4-(1,4-thiazepan-4-yl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103325584 |
| Molecular Formula | C14H20N4S2 |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-propyl-4-(1,4-thiazepan-4-yl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCCNc1nc(N2CCCSCC2)c2ccsc2n1 |
| InChI | InChI=1S/C14H20N4S2/c1-2-5-15-14-16-12(11-4-9-20-13(11)17-14)18-6-3-8-19-10-7-18/h4,9H,2-3,5-8,10H2,1H3,(H,15,16,17) |
| InChIKey | UPPHLPVEPBCDAC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |