C12H16N4O2S — CID 106674469
1-[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]pyrrolidine-3,4-diol (PubChem CID 106674469) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]pyrrolidine-3,4-diol.
| Compound Name | 1-[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674469 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-[2-(ethylamino)thieno[2,3-d]pyrimidin-4-yl]pyrrolidine-3,4-diol |
| SMILES | CCNc1nc(N2CC(O)C(O)C2)c2ccsc2n1 |
| InChI | InChI=1S/C12H16N4O2S/c1-2-13-12-14-10(7-3-4-19-11(7)15-12)16-5-8(17)9(18)6-16/h3-4,8-9,17-18H,2,5-6H2,1H3,(H,13,14,15) |
| InChIKey | LWKNKBMWORQOCB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |