C12H16N4OS — CID 103327477
N-methyl-4-(1,4-oxazepan-4-yl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103327477) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is N-methyl-4-(1,4-oxazepan-4-yl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | N-methyl-4-(1,4-oxazepan-4-yl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103327477 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-methyl-4-(1,4-oxazepan-4-yl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1nc(N2CCCOCC2)c2ccsc2n1 |
| InChI | InChI=1S/C12H16N4OS/c1-13-12-14-10(9-3-8-18-11(9)15-12)16-4-2-6-17-7-5-16/h3,8H,2,4-7H2,1H3,(H,13,14,15) |
| InChIKey | YDCOVQPQSBKCCG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |