C13H18N4OS — CID 103325050
4-(2-ethylmorpholin-4-yl)-N-methylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103325050) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-(2-ethylmorpholin-4-yl)-N-methylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(2-ethylmorpholin-4-yl)-N-methylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103325050 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-(2-ethylmorpholin-4-yl)-N-methylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCC1CN(c2nc(NC)nc3sccc23)CCO1 |
| InChI | InChI=1S/C13H18N4OS/c1-3-9-8-17(5-6-18-9)11-10-4-7-19-12(10)16-13(14-2)15-11/h4,7,9H,3,5-6,8H2,1-2H3,(H,14,15,16) |
| InChIKey | FCAAIKMXORORNW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |