C16H22N4S — CID 103325254
4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103325254) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103325254 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1nc(N2CCC3CCCCC3C2)c2ccsc2n1 |
| InChI | InChI=1S/C16H22N4S/c1-17-16-18-14(13-7-9-21-15(13)19-16)20-8-6-11-4-2-3-5-12(11)10-20/h7,9,11-12H,2-6,8,10H2,1H3,(H,17,18,19) |
| InChIKey | YZHZERRIIQOUMB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |