C13H19F5N6 — CID 146106372
4-(4-butan-2-ylpiperazin-1-yl)-6-(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazin-2-amine (PubChem CID 146106372) has the molecular formula C13H19F5N6 and a molecular weight of 354.33 g/mol. Its IUPAC name is 4-(4-butan-2-ylpiperazin-1-yl)-6-(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-butan-2-ylpiperazin-1-yl)-6-(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 146106372 |
| Molecular Formula | C13H19F5N6 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-(4-butan-2-ylpiperazin-1-yl)-6-(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazin-2-amine |
| SMILES | CCC(C)N1CCN(c2nc(N)nc(C(F)(F)C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C13H19F5N6/c1-3-8(2)23-4-6-24(7-5-23)11-21-9(20-10(19)22-11)12(14,15)13(16,17)18/h8H,3-7H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | JUSUTMUWZMGBNE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|