C9H13N5O2 — CID 165494645
2-amino-6-piperazin-1-ylpyrimidine-4-carboxylic acid (PubChem CID 165494645) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 2-amino-6-piperazin-1-ylpyrimidine-4-carboxylic acid.
| Compound Name | 2-amino-6-piperazin-1-ylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 165494645 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-amino-6-piperazin-1-ylpyrimidine-4-carboxylic acid |
| SMILES | Nc1nc(C(=O)O)cc(N2CCNCC2)n1 |
| InChI | InChI=1S/C9H13N5O2/c10-9-12-6(8(15)16)5-7(13-9)14-3-1-11-2-4-14/h5,11H,1-4H2,(H,15,16)(H2,10,12,13) |
| InChIKey | ADTGPDOVEWNEJF-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |