C12H16ClFN2 — CID 84801852
1-(4-chloro-3-fluoro-2,5-dimethylphenyl)piperazine (PubChem CID 84801852) has the molecular formula C12H16ClFN2 and a molecular weight of 242.72 g/mol. Its IUPAC name is 1-(4-chloro-3-fluoro-2,5-dimethylphenyl)piperazine.
| Compound Name | 1-(4-chloro-3-fluoro-2,5-dimethylphenyl)piperazine |
|---|---|
| PubChem CID | 84801852 |
| Molecular Formula | C12H16ClFN2 |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-(4-chloro-3-fluoro-2,5-dimethylphenyl)piperazine |
| SMILES | Cc1cc(N2CCNCC2)c(C)c(F)c1Cl |
| InChI | InChI=1S/C12H16ClFN2/c1-8-7-10(9(2)12(14)11(8)13)16-5-3-15-4-6-16/h7,15H,3-6H2,1-2H3 |
| InChIKey | OLNBKVFXEJAANI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |