About 1-(4,5-difluoro-2-methylphenyl)piperazine
1-(4,5-difluoro-2-methylphenyl)piperazine (PubChem CID 84782277) has the molecular formula C11H14F2N2
and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-(4,5-difluoro-2-methylphenyl)piperazine.
Molecular Properties
| Compound Name | 1-(4,5-difluoro-2-methylphenyl)piperazine |
| PubChem CID | 84782277 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-(4,5-difluoro-2-methylphenyl)piperazine |
| SMILES | Cc1cc(F)c(F)cc1N1CCNCC1 |
| InChI | InChI=1S/C11H14F2N2/c1-8-6-9(12)10(13)7-11(8)15-4-2-14-3-5-15/h6-7,14H,2-5H2,1H3 |
| InChIKey | PIZFNPZMLCYOTH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4,5-difluoro-2-methylphenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-difluoro-2-methylphenyl)piperazine?
The IUPAC name of 1-(4,5-difluoro-2-methylphenyl)piperazine (CID 84782277) is 1-(4,5-difluoro-2-methylphenyl)piperazine.
What is the SMILES notation for 1-(4,5-difluoro-2-methylphenyl)piperazine?
The canonical SMILES for 1-(4,5-difluoro-2-methylphenyl)piperazine is Cc1cc(F)c(F)cc1N1CCNCC1.
What is the InChIKey of 1-(4,5-difluoro-2-methylphenyl)piperazine?
The InChIKey is PIZFNPZMLCYOTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N2/c1-8-6-9(12)10(13)7-11(8)15-4-2-14-3-5-15/h6-7,14H,2-5H2,1H3.
What are the key properties of 1-(4,5-difluoro-2-methylphenyl)piperazine?
1-(4,5-difluoro-2-methylphenyl)piperazine has a molecular weight of 212.24 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-difluoro-2-methylphenyl)piperazine is sourced from PubChem (CID 84782277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).