C11H14F2N2 — CID 84782277
1-(4,5-difluoro-2-methylphenyl)piperazine (PubChem CID 84782277) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-(4,5-difluoro-2-methylphenyl)piperazine.
| Compound Name | 1-(4,5-difluoro-2-methylphenyl)piperazine |
|---|---|
| PubChem CID | 84782277 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-(4,5-difluoro-2-methylphenyl)piperazine |
| SMILES | Cc1cc(F)c(F)cc1N1CCNCC1 |
| InChI | InChI=1S/C11H14F2N2/c1-8-6-9(12)10(13)7-11(8)15-4-2-14-3-5-15/h6-7,14H,2-5H2,1H3 |
| InChIKey | PIZFNPZMLCYOTH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |