C13H20N5+ — CID 90022369
1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,2,4-triamine (PubChem CID 90022369) has the molecular formula C13H20N5+ and a molecular weight of 246.34 g/mol. Its IUPAC name is 1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,2,4-triamine.
| Compound Name | 1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 90022369 |
| Molecular Formula | C13H20N5+ |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,2,4-triamine |
| SMILES | C[n+]1ccn(CCCNc2ccc(N)cc2N)c1 |
| InChI | InChI=1S/C13H20N5/c1-17-7-8-18(10-17)6-2-5-16-13-4-3-11(14)9-12(13)15/h3-4,7-10,16H,2,5-6,14-15H2,1H3/q+1 |
| InChIKey | NEXUBZQUMKJFHG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|