C12H21N3O — CID 143590092
6-(2,4-diaminoanilino)hexan-1-ol (PubChem CID 143590092) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 6-(2,4-diaminoanilino)hexan-1-ol.
| Compound Name | 6-(2,4-diaminoanilino)hexan-1-ol |
|---|---|
| PubChem CID | 143590092 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 6-(2,4-diaminoanilino)hexan-1-ol |
| SMILES | Nc1ccc(NCCCCCCO)c(N)c1 |
| InChI | InChI=1S/C12H21N3O/c13-10-5-6-12(11(14)9-10)15-7-3-1-2-4-8-16/h5-6,9,15-16H,1-4,7-8,13-14H2 |
| InChIKey | QUDSJQZBMPBAGV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|