C11H20N4 — CID 164917837
1-N-[4-(methylamino)butyl]benzene-1,2,4-triamine (PubChem CID 164917837) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-N-[4-(methylamino)butyl]benzene-1,2,4-triamine.
| Compound Name | 1-N-[4-(methylamino)butyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 164917837 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-N-[4-(methylamino)butyl]benzene-1,2,4-triamine |
| SMILES | CNCCCCNc1ccc(N)cc1N |
| InChI | InChI=1S/C11H20N4/c1-14-6-2-3-7-15-11-5-4-9(12)8-10(11)13/h4-5,8,14-15H,2-3,6-7,12-13H2,1H3 |
| InChIKey | WWSXGZRGODCHKE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|