C32H42N10+2 — CID 135141333
2-N,4-N-bis[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]benzene-1,2,4,5-tetramine (PubChem CID 135141333) has the molecular formula C32H42N10+2 and a molecular weight of 566.76 g/mol. Its IUPAC name is 2-N,4-N-bis[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]benzene-1,2,4,5-tetramine.
| Compound Name | 2-N,4-N-bis[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]benzene-1,2,4,5-tetramine |
|---|---|
| PubChem CID | 135141333 |
| Molecular Formula | C32H42N10+2 |
| Molecular Weight | 566.76 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | 2-N,4-N-bis[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]benzene-1,2,4,5-tetramine |
| SMILES | C[n+]1ccn(CCCNc2ccc(Nc3cc(Nc4ccc(NCCCn5cc[n+](C)c5)cc4)c(N)cc3N)cc2)c1 |
| InChI | InChI=1S/C32H42N10/c1-39-17-19-41(23-39)15-3-13-35-25-5-9-27(10-6-25)37-31-22-32(30(34)21-29(31)33)38-28-11-7-26(8-12-28)36-14-4-16-42-20-18-40(2)24-42/h5-12,17-24,35-38H,3-4,13-16,33-34H2,1-2H3/q+2 |
| InChIKey | BMIRDUPRWAWMBT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|