About 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine
4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine (PubChem CID 158797248) has the molecular formula C13H19N4+
and a molecular weight of 231.32 g/mol. Its IUPAC name is 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine.
Molecular Properties
| Compound Name | 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine |
| PubChem CID | 158797248 |
| Molecular Formula | C13H19N4+ |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine |
| SMILES | C[n+]1ccn(CCCc2ccc(N)cc2N)c1 |
| InChI | InChI=1S/C13H19N4/c1-16-7-8-17(10-16)6-2-3-11-4-5-12(14)9-13(11)15/h4-5,7-10H,2-3,6,14-15H2,1H3/q+1 |
| InChIKey | VXDULSITLDGCAR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine?
The IUPAC name of 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine (CID 158797248) is 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine.
What is the SMILES notation for 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine?
The canonical SMILES for 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine is C[n+]1ccn(CCCc2ccc(N)cc2N)c1.
What is the InChIKey of 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine?
The InChIKey is VXDULSITLDGCAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N4/c1-16-7-8-17(10-16)6-2-3-11-4-5-12(14)9-13(11)15/h4-5,7-10H,2-3,6,14-15H2,1H3/q+1.
What are the key properties of 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine?
4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine has a molecular weight of 231.32 g/mol, XLogP of 1.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,3-diamine is sourced from PubChem (CID 158797248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).