C27H31N5O2+2 — CID 58261039
6-[4-(3-methylimidazol-3-ium-1-yl)butyl]-2-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 58261039) has the molecular formula C27H31N5O2+2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 6-[4-(3-methylimidazol-3-ium-1-yl)butyl]-2-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-[4-(3-methylimidazol-3-ium-1-yl)butyl]-2-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 58261039 |
| Molecular Formula | C27H31N5O2+2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 6-[4-(3-methylimidazol-3-ium-1-yl)butyl]-2-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | C[n+]1ccn(CCCCc2ccc3c4c(cccc24)C(=O)N(CCCn2cc[n+](C)c2)C3=O)c1 |
| InChI | InChI=1S/C27H31N5O2/c1-28-15-17-30(19-28)12-4-3-7-21-10-11-24-25-22(21)8-5-9-23(25)26(33)32(27(24)34)14-6-13-31-18-16-29(2)20-31/h5,8-11,15-20H,3-4,6-7,12-14H2,1-2H3/q+2 |
| InChIKey | ZUSKWTMXWAKMQQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|