C21H22IN3O2S — CID 171352515
6-ethylsulfanyl-2-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzo[de]isoquinoline-1,3-dione iodide (PubChem CID 171352515) has the molecular formula C21H22IN3O2S and a molecular weight of 507.40 g/mol. Its IUPAC name is 6-ethylsulfanyl-2-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzo[de]isoquinoline-1,3-dione iodide.
| Compound Name | 6-ethylsulfanyl-2-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzo[de]isoquinoline-1,3-dione iodide |
|---|---|
| PubChem CID | 171352515 |
| Molecular Formula | C21H22IN3O2S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | 6-ethylsulfanyl-2-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzo[de]isoquinoline-1,3-dione iodide |
| SMILES | CCSc1ccc2c3c(cccc13)C(=O)N(CCCn1cc[n+](C)c1)C2=O.[I-] |
| InChI | InChI=1S/C21H22N3O2S.HI/c1-3-27-18-9-8-17-19-15(18)6-4-7-16(19)20(25)24(21(17)26)11-5-10-23-13-12-22(2)14-23;/h4,6-9,12-14H,3,5,10-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | IICLBBRVBZVMMR-UHFFFAOYSA-M |
| XLogP | 0.27 |
| TPSA | 46.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|