C14H21ClN4 — CID 87840635
2-methyl-1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,4-diamine chloride (PubChem CID 87840635) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-methyl-1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,4-diamine chloride.
| Compound Name | 2-methyl-1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,4-diamine chloride |
|---|---|
| PubChem CID | 87840635 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-methyl-1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]benzene-1,4-diamine chloride |
| SMILES | Cc1cc(N)ccc1NCCCn1cc[n+](C)c1.[Cl-] |
| InChI | InChI=1S/C14H21N4.ClH/c1-12-10-13(15)4-5-14(12)16-6-3-7-18-9-8-17(2)11-18;/h4-5,8-11,16H,3,6-7,15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | UPYDJGUUEBZAJH-UHFFFAOYSA-M |
| XLogP | -1.29 |
| TPSA | 46.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|