C11H16ClN6+ — CID 166965393
4-chloro-6-methyl-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]-1,3,5-triazin-2-amine (PubChem CID 166965393) has the molecular formula C11H16ClN6+ and a molecular weight of 267.74 g/mol. Its IUPAC name is 4-chloro-6-methyl-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-methyl-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 166965393 |
| Molecular Formula | C11H16ClN6+ |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-chloro-6-methyl-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]-1,3,5-triazin-2-amine |
| SMILES | Cc1nc(Cl)nc(NCCCn2cc[n+](C)c2)n1 |
| InChI | InChI=1S/C11H16ClN6/c1-9-14-10(12)16-11(15-9)13-4-3-5-18-7-6-17(2)8-18/h6-8H,3-5H2,1-2H3,(H,13,14,15,16)/q+1 |
| InChIKey | YMEAVROHLCFUMO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|