C14H20N5O2+ — CID 18413426
3-N-methyl-1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]-4-nitrobenzene-1,3-diamine (PubChem CID 18413426) has the molecular formula C14H20N5O2+ and a molecular weight of 290.35 g/mol. Its IUPAC name is 3-N-methyl-1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]-4-nitrobenzene-1,3-diamine.
| Compound Name | 3-N-methyl-1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]-4-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 18413426 |
| Molecular Formula | C14H20N5O2+ |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 3-N-methyl-1-N-[3-(3-methylimidazol-3-ium-1-yl)propyl]-4-nitrobenzene-1,3-diamine |
| SMILES | CNc1cc(NCCCn2cc[n+](C)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N5O2/c1-15-13-10-12(4-5-14(13)19(20)21)16-6-3-7-18-9-8-17(2)11-18/h4-5,8-11,15-16H,3,6-7H2,1-2H3/q+1 |
| InChIKey | QVMSCTFZHFEGPX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|