C28H36N7O+ — CID 155329457
2-N-(4-ethoxyphenyl)-1-N-methyl-4-N-[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]benzene-1,2,4,5-tetramine (PubChem CID 155329457) has the molecular formula C28H36N7O+ and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-N-(4-ethoxyphenyl)-1-N-methyl-4-N-[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]benzene-1,2,4,5-tetramine.
| Compound Name | 2-N-(4-ethoxyphenyl)-1-N-methyl-4-N-[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]benzene-1,2,4,5-tetramine |
|---|---|
| PubChem CID | 155329457 |
| Molecular Formula | C28H36N7O+ |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 2-N-(4-ethoxyphenyl)-1-N-methyl-4-N-[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]benzene-1,2,4,5-tetramine |
| SMILES | CCOc1ccc(Nc2cc(Nc3ccc(NCCCn4cc[n+](C)c4)cc3)c(N)cc2NC)cc1 |
| InChI | InChI=1S/C28H36N7O/c1-4-36-24-12-10-23(11-13-24)33-28-19-26(25(29)18-27(28)30-2)32-22-8-6-21(7-9-22)31-14-5-15-35-17-16-34(3)20-35/h6-13,16-20,30-33H,4-5,14-15,29H2,1-3H3/q+1 |
| InChIKey | YKGURGAQPOLFRA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|