C31H38N10O+2 — CID 123154265
2-amino-5,6-bis[[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]imino]pyridin-3-one (PubChem CID 123154265) has the molecular formula C31H38N10O+2 and a molecular weight of 566.71 g/mol. Its IUPAC name is 2-amino-5,6-bis[[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]imino]pyridin-3-one.
| Compound Name | 2-amino-5,6-bis[[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]imino]pyridin-3-one |
|---|---|
| PubChem CID | 123154265 |
| Molecular Formula | C31H38N10O+2 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | 2-amino-5,6-bis[[4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]phenyl]imino]pyridin-3-one |
| SMILES | C[n+]1ccn(CCCNc2ccc(/N=C3\N=C(N)C(=O)C\C3=N/c3ccc(NCCCn4cc[n+](C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C31H37N10O/c1-38-17-19-40(22-38)15-3-13-33-24-5-9-26(10-6-24)35-28-21-29(42)30(32)37-31(28)36-27-11-7-25(8-12-27)34-14-4-16-41-20-18-39(2)23-41/h5-12,17-20,22-23H,3-4,13-16,21H2,1-2H3,(H3-,32,33,34,35,36,37,42)/q+1/p+1 |
| InChIKey | YRWWAPRMPACROH-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|