C18H33ClN4O — CID 159580952
[3-[4-(4-amino-3-methylphenyl)-1,4-diazepan-1-yl]-2-hydroxypropyl]-trimethylazanium chloride (PubChem CID 159580952) has the molecular formula C18H33ClN4O and a molecular weight of 356.94 g/mol. Its IUPAC name is [3-[4-(4-amino-3-methylphenyl)-1,4-diazepan-1-yl]-2-hydroxypropyl]-trimethylazanium chloride.
| Compound Name | [3-[4-(4-amino-3-methylphenyl)-1,4-diazepan-1-yl]-2-hydroxypropyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 159580952 |
| Molecular Formula | C18H33ClN4O |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | [3-[4-(4-amino-3-methylphenyl)-1,4-diazepan-1-yl]-2-hydroxypropyl]-trimethylazanium chloride |
| SMILES | Cc1cc(N2CCCN(CC(O)C[N+](C)(C)C)CC2)ccc1N.[Cl-] |
| InChI | InChI=1S/C18H33N4O.ClH/c1-15-12-16(6-7-18(15)19)21-9-5-8-20(10-11-21)13-17(23)14-22(2,3)4;/h6-7,12,17,23H,5,8-11,13-14,19H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | MIZVNIFCKZFFNN-UHFFFAOYSA-M |
| XLogP | -1.84 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|