C24H42N8 — CID 10160597
2-N-[2-[2-[2-(2,5-diamino-N-hexylanilino)ethylamino]ethylamino]ethyl]benzene-1,2,4-triamine (PubChem CID 10160597) has the molecular formula C24H42N8 and a molecular weight of 442.66 g/mol. Its IUPAC name is 2-N-[2-[2-[2-(2,5-diamino-N-hexylanilino)ethylamino]ethylamino]ethyl]benzene-1,2,4-triamine.
| Compound Name | 2-N-[2-[2-[2-(2,5-diamino-N-hexylanilino)ethylamino]ethylamino]ethyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 10160597 |
| Molecular Formula | C24H42N8 |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.35 |
| IUPAC Name | 2-N-[2-[2-[2-(2,5-diamino-N-hexylanilino)ethylamino]ethylamino]ethyl]benzene-1,2,4-triamine |
| SMILES | CCCCCCN(CCNCCNCCNc1cc(N)ccc1N)c1cc(N)ccc1N |
| InChI | InChI=1S/C24H42N8/c1-2-3-4-5-15-32(24-18-20(26)7-9-22(24)28)16-14-30-11-10-29-12-13-31-23-17-19(25)6-8-21(23)27/h6-9,17-18,29-31H,2-5,10-16,25-28H2,1H3 |
| InChIKey | KXBXQMIYVHNUBR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 143.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|