C8H14N4 — CID 57040010
2-N-(2-aminoethyl)benzene-1,2,4-triamine (PubChem CID 57040010) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 2-N-(2-aminoethyl)benzene-1,2,4-triamine.
| Compound Name | 2-N-(2-aminoethyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 57040010 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 2-N-(2-aminoethyl)benzene-1,2,4-triamine |
| SMILES | NCCNc1cc(N)ccc1N |
| InChI | InChI=1S/C8H14N4/c9-3-4-12-8-5-6(10)1-2-7(8)11/h1-2,5,12H,3-4,9-11H2 |
| InChIKey | GWXKAECSGHZHGY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|