C10H16N2 — CID 58056820
4-methyl-2-N-propylbenzene-1,2-diamine (PubChem CID 58056820) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 4-methyl-2-N-propylbenzene-1,2-diamine.
| Compound Name | 4-methyl-2-N-propylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 58056820 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 4-methyl-2-N-propylbenzene-1,2-diamine |
| SMILES | CCCNc1cc(C)ccc1N |
| InChI | InChI=1S/C10H16N2/c1-3-6-12-10-7-8(2)4-5-9(10)11/h4-5,7,12H,3,6,11H2,1-2H3 |
| InChIKey | IZVTXYZJJRKRLG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|