C11H20N2 — CID 138693326
butane;4-methylbenzene-1,2-diamine (PubChem CID 138693326) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is butane;4-methylbenzene-1,2-diamine.
| Compound Name | butane;4-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 138693326 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | butane;4-methylbenzene-1,2-diamine |
| SMILES | CCCC.Cc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C7H10N2.C4H10/c1-5-2-3-6(8)7(9)4-5;1-3-4-2/h2-4H,8-9H2,1H3;3-4H2,1-2H3 |
| InChIKey | KOZIOEGZHBVXNB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|