About 2-chloro-4-methylaniline
2-chloro-4-methylaniline (PubChem CID 12007) has the molecular formula C7H8ClN
and a molecular weight of 141.60 g/mol. Its IUPAC name is 2-chloro-4-methylaniline.
Molecular Properties
| Compound Name | 2-chloro-4-methylaniline |
| PubChem CID | 12007 |
| Molecular Formula | C7H8ClN |
| Molecular Weight | 141.60 g/mol |
| Exact Mass | 141.03 |
| IUPAC Name | 2-chloro-4-methylaniline |
| SMILES | Cc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C7H8ClN/c1-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3 |
| InChIKey | XGYLSRFSXKAYCR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methylaniline?
The IUPAC name of 2-chloro-4-methylaniline (CID 12007) is 2-chloro-4-methylaniline.
What is the SMILES notation for 2-chloro-4-methylaniline?
The canonical SMILES for 2-chloro-4-methylaniline is Cc1ccc(N)c(Cl)c1.
What is the InChIKey of 2-chloro-4-methylaniline?
The InChIKey is XGYLSRFSXKAYCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN/c1-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3.
What are the key properties of 2-chloro-4-methylaniline?
2-chloro-4-methylaniline has a molecular weight of 141.60 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methylaniline is sourced from PubChem (CID 12007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).