C9H15N3 — CID 23104425
2-N-(2-aminoethyl)-4-methylbenzene-1,2-diamine (PubChem CID 23104425) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-N-(2-aminoethyl)-4-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(2-aminoethyl)-4-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 23104425 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 2-N-(2-aminoethyl)-4-methylbenzene-1,2-diamine |
| SMILES | Cc1ccc(N)c(NCCN)c1 |
| InChI | InChI=1S/C9H15N3/c1-7-2-3-8(11)9(6-7)12-5-4-10/h2-3,6,12H,4-5,10-11H2,1H3 |
| InChIKey | JKFMWMAAYLKCNK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|