C15H32N4O2 — CID 162439486
1-N-(2-aminoethyl)-2-nitrobenzene-1,4-diamine;ethane;propane (PubChem CID 162439486) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-2-nitrobenzene-1,4-diamine;ethane;propane.
| Compound Name | 1-N-(2-aminoethyl)-2-nitrobenzene-1,4-diamine;ethane;propane |
|---|---|
| PubChem CID | 162439486 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 1-N-(2-aminoethyl)-2-nitrobenzene-1,4-diamine;ethane;propane |
| SMILES | CC.CC.CCC.NCCNc1ccc(N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N4O2.C3H8.2C2H6/c9-3-4-11-7-2-1-6(10)5-8(7)12(13)14;1-3-2;2*1-2/h1-2,5,11H,3-4,9-10H2;3H2,1-2H3;2*1-2H3 |
| InChIKey | KJQXGOBFNOHALI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|