C12H18Cl2N2 — CID 60788789
N-[(3,5-dichlorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 60788789) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 60788789 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H18Cl2N2/c1-16(2)5-3-4-15-9-10-6-11(13)8-12(14)7-10/h6-8,15H,3-5,9H2,1-2H3 |
| InChIKey | LVJPBNQABMLZMZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|