C11H20N2O — CID 114820562
N',N'-dimethyl-N-[(5-methylfuran-3-yl)methyl]propane-1,3-diamine (PubChem CID 114820562) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(5-methylfuran-3-yl)methyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[(5-methylfuran-3-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 114820562 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N',N'-dimethyl-N-[(5-methylfuran-3-yl)methyl]propane-1,3-diamine |
| SMILES | Cc1cc(CNCCCN(C)C)co1 |
| InChI | InChI=1S/C11H20N2O/c1-10-7-11(9-14-10)8-12-5-4-6-13(2)3/h7,9,12H,4-6,8H2,1-3H3 |
| InChIKey | WZYKYEMRSICCGQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|