C11H20N2O — CID 114820512
N'-[(5-methylfuran-3-yl)methyl]-N-propylethane-1,2-diamine (PubChem CID 114820512) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N'-[(5-methylfuran-3-yl)methyl]-N-propylethane-1,2-diamine.
| Compound Name | N'-[(5-methylfuran-3-yl)methyl]-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 114820512 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N'-[(5-methylfuran-3-yl)methyl]-N-propylethane-1,2-diamine |
| SMILES | CCCNCCNCc1coc(C)c1 |
| InChI | InChI=1S/C11H20N2O/c1-3-4-12-5-6-13-8-11-7-10(2)14-9-11/h7,9,12-13H,3-6,8H2,1-2H3 |
| InChIKey | WXANZOLPHPJTLJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|