C9H15NO — CID 114820468
N-[(5-methylfuran-3-yl)methyl]propan-1-amine (PubChem CID 114820468) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is N-[(5-methylfuran-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-methylfuran-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114820468 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-[(5-methylfuran-3-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1coc(C)c1 |
| InChI | InChI=1S/C9H15NO/c1-3-4-10-6-9-5-8(2)11-7-9/h5,7,10H,3-4,6H2,1-2H3 |
| InChIKey | KLCDAZODFYSJPW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|