C26H50N4 — CID 146687225
N-[[3-[5-[3-(dimethylamino)propylamino]pentyl]phenyl]methyl]-N',N'-dimethylheptane-1,7-diamine (PubChem CID 146687225) has the molecular formula C26H50N4 and a molecular weight of 418.71 g/mol. Its IUPAC name is N-[[3-[5-[3-(dimethylamino)propylamino]pentyl]phenyl]methyl]-N',N'-dimethylheptane-1,7-diamine.
| Compound Name | N-[[3-[5-[3-(dimethylamino)propylamino]pentyl]phenyl]methyl]-N',N'-dimethylheptane-1,7-diamine |
|---|---|
| PubChem CID | 146687225 |
| Molecular Formula | C26H50N4 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.40 |
| IUPAC Name | N-[[3-[5-[3-(dimethylamino)propylamino]pentyl]phenyl]methyl]-N',N'-dimethylheptane-1,7-diamine |
| SMILES | CN(C)CCCCCCCNCc1cccc(CCCCCNCCCN(C)C)c1 |
| InChI | InChI=1S/C26H50N4/c1-29(2)21-12-7-5-6-10-19-28-24-26-17-13-16-25(23-26)15-9-8-11-18-27-20-14-22-30(3)4/h13,16-17,23,27-28H,5-12,14-15,18-22,24H2,1-4H3 |
| InChIKey | PSZVFGRYKKUXIF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|