C16H28N2 — CID 172845275
5-[3-(3-aminopropyl)phenyl]-N,N-dimethylpentan-1-amine (PubChem CID 172845275) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 5-[3-(3-aminopropyl)phenyl]-N,N-dimethylpentan-1-amine.
| Compound Name | 5-[3-(3-aminopropyl)phenyl]-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 172845275 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 5-[3-(3-aminopropyl)phenyl]-N,N-dimethylpentan-1-amine |
| SMILES | CN(C)CCCCCc1cccc(CCCN)c1 |
| InChI | InChI=1S/C16H28N2/c1-18(2)13-5-3-4-8-15-9-6-10-16(14-15)11-7-12-17/h6,9-10,14H,3-5,7-8,11-13,17H2,1-2H3 |
| InChIKey | XIGNVECGSGLDFY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|